C22H29N3O5S — CID 42996635
2-[3-(azepan-1-ylsulfonyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 42996635) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[3-(azepan-1-ylsulfonyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[3-(azepan-1-ylsulfonyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42996635 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2-[3-(azepan-1-ylsulfonyl)anilino]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2cccc(S(=O)(=O)N3CCCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-29-18-10-11-20(21(15-18)30-2)24-22(26)16-23-17-8-7-9-19(14-17)31(27,28)25-12-5-3-4-6-13-25/h7-11,14-15,23H,3-6,12-13,16H2,1-2H3,(H,24,26) |
| InChIKey | SXBUJZBZLXTOQK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |