C21H28N4O5S2 — CID 16553103
N-[3-(dimethylsulfamoyl)phenyl]-2-(3-piperidin-1-ylsulfonylanilino)acetamide (PubChem CID 16553103) has the molecular formula C21H28N4O5S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(3-piperidin-1-ylsulfonylanilino)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-piperidin-1-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 16553103 |
| Molecular Formula | C21H28N4O5S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(3-piperidin-1-ylsulfonylanilino)acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CNc2cccc(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C21H28N4O5S2/c1-24(2)31(27,28)19-10-7-9-18(15-19)23-21(26)16-22-17-8-6-11-20(14-17)32(29,30)25-12-4-3-5-13-25/h6-11,14-15,22H,3-5,12-13,16H2,1-2H3,(H,23,26) |
| InChIKey | JKBLPZWIGMAUDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |