C18H23N3O3S — CID 4879510
N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)anilino]acetamide (PubChem CID 4879510) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)anilino]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)anilino]acetamide |
|---|---|
| PubChem CID | 4879510 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[3-(dimethylsulfamoyl)anilino]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CNc2cccc(S(=O)(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C18H23N3O3S/c1-13-8-14(2)10-16(9-13)20-18(22)12-19-15-6-5-7-17(11-15)25(23,24)21(3)4/h5-11,19H,12H2,1-4H3,(H,20,22) |
| InChIKey | CQQOVKDOFTUTSN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |