C16H17BrFN3O3S — CID 42125792
2-(4-bromo-2-fluoroanilino)-N-[3-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 42125792) has the molecular formula C16H17BrFN3O3S and a molecular weight of 430.30 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoroanilino)-N-[3-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromo-2-fluoroanilino)-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42125792 |
| Molecular Formula | C16H17BrFN3O3S |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 2-(4-bromo-2-fluoroanilino)-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CNc2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C16H17BrFN3O3S/c1-21(2)25(23,24)13-5-3-4-12(9-13)20-16(22)10-19-15-7-6-11(17)8-14(15)18/h3-9,19H,10H2,1-2H3,(H,20,22) |
| InChIKey | AKJJSXAIYWQMEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |