C18H22BrFN4O3S — CID 4884599
N-(4-bromo-2-fluorophenyl)-2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetamide (PubChem CID 4884599) has the molecular formula C18H22BrFN4O3S and a molecular weight of 473.37 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetamide |
|---|---|
| PubChem CID | 4884599 |
| Molecular Formula | C18H22BrFN4O3S |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H22BrFN4O3S/c1-4-21-16-8-6-13(28(26,27)24(2)3)10-17(16)22-11-18(25)23-15-7-5-12(19)9-14(15)20/h5-10,21-22H,4,11H2,1-3H3,(H,23,25) |
| InChIKey | ASPUFLUJCWPKDU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |