C13H21N3O4S — CID 24541409
methyl 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetate (PubChem CID 24541409) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is methyl 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetate.
| Compound Name | methyl 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetate |
|---|---|
| PubChem CID | 24541409 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]acetate |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)OC |
| InChI | InChI=1S/C13H21N3O4S/c1-5-14-11-7-6-10(21(18,19)16(2)3)8-12(11)15-9-13(17)20-4/h6-8,14-15H,5,9H2,1-4H3 |
| InChIKey | PFFBNCTZVPODEU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |