C14H21Cl2N3O2S — CID 25352213
3-[[(1S)-2,2-dichlorocyclopropyl]methylamino]-4-(ethylamino)-N,N-dimethylbenzenesulfonamide (PubChem CID 25352213) has the molecular formula C14H21Cl2N3O2S and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-[[(1S)-2,2-dichlorocyclopropyl]methylamino]-4-(ethylamino)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methylamino]-4-(ethylamino)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25352213 |
| Molecular Formula | C14H21Cl2N3O2S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methylamino]-4-(ethylamino)-N,N-dimethylbenzenesulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NC[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C14H21Cl2N3O2S/c1-4-17-12-6-5-11(22(20,21)19(2)3)7-13(12)18-9-10-8-14(10,15)16/h5-7,10,17-18H,4,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | PVSPZMULGYUFQG-JTQLQIEISA-N |
| XLogP | 2.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|