C19H32N4O3S — CID 51160031
2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-methylcyclohexyl)acetamide (PubChem CID 51160031) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-methylcyclohexyl)acetamide.
| Compound Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 51160031 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-methylcyclohexyl)acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)NC1CCCCC1C |
| InChI | InChI=1S/C19H32N4O3S/c1-5-20-17-11-10-15(27(25,26)23(3)4)12-18(17)21-13-19(24)22-16-9-7-6-8-14(16)2/h10-12,14,16,20-21H,5-9,13H2,1-4H3,(H,22,24) |
| InChIKey | VHKDBMIBKCCKRP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |