C21H30N4O3S — CID 9106574
2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 9106574) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9106574 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[5-(dimethylsulfamoyl)-2-(ethylamino)anilino]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)C)cc1NCC(=O)Nc1c(C)cccc1CC |
| InChI | InChI=1S/C21H30N4O3S/c1-6-16-10-8-9-15(3)21(16)24-20(26)14-23-19-13-17(29(27,28)25(4)5)11-12-18(19)22-7-2/h8-13,22-23H,6-7,14H2,1-5H3,(H,24,26) |
| InChIKey | VMGMZAMAPFJJJL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |