C21H29N5O2S3 — CID 3562315
1-(2,6-diethylphenyl)-3-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylamino]thiourea (PubChem CID 3562315) has the molecular formula C21H29N5O2S3 and a molecular weight of 479.70 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylamino]thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 3562315 |
| Molecular Formula | C21H29N5O2S3 |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylamino]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NNC(=S)Nc1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C21H29N5O2S3/c1-6-15-9-8-10-16(7-2)19(15)23-21(30)25-24-20(29)22-18-13-17(12-11-14(18)3)31(27,28)26(4)5/h8-13H,6-7H2,1-5H3,(H2,22,24,29)(H2,23,25,30) |
| InChIKey | LTVGHNIAUJXDAP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|