C20H25BrN4O3S3 — CID 5009471
1-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea (PubChem CID 5009471) has the molecular formula C20H25BrN4O3S3 and a molecular weight of 545.55 g/mol. Its IUPAC name is 1-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea.
| Compound Name | 1-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
|---|---|
| PubChem CID | 5009471 |
| Molecular Formula | C20H25BrN4O3S3 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 1-[[2-(4-bromo-2,5-dimethylphenyl)sulfanylacetyl]amino]-3-[5-(dimethylsulfamoyl)-2-methylphenyl]thiourea |
| SMILES | Cc1cc(SCC(=O)NNC(=S)Nc2cc(S(=O)(=O)N(C)C)ccc2C)c(C)cc1Br |
| InChI | InChI=1S/C20H25BrN4O3S3/c1-12-6-7-15(31(27,28)25(4)5)10-17(12)22-20(29)24-23-19(26)11-30-18-9-13(2)16(21)8-14(18)3/h6-10H,11H2,1-5H3,(H,23,26)(H2,22,24,29) |
| InChIKey | MRRAZJBHJSNHJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|