C18H21N3OS2 — CID 8682794
1-(2,5-dimethylphenyl)-3-[[2-(4-methylphenyl)sulfanylacetyl]amino]thiourea (PubChem CID 8682794) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[[2-(4-methylphenyl)sulfanylacetyl]amino]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[[2-(4-methylphenyl)sulfanylacetyl]amino]thiourea |
|---|---|
| PubChem CID | 8682794 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[[2-(4-methylphenyl)sulfanylacetyl]amino]thiourea |
| SMILES | Cc1ccc(SCC(=O)NNC(=S)Nc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H21N3OS2/c1-12-5-8-15(9-6-12)24-11-17(22)20-21-18(23)19-16-10-13(2)4-7-14(16)3/h4-10H,11H2,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | RFKJPKLHZCJRSS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|