C18H21N3OS3 — CID 9095240
1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 9095240) has the molecular formula C18H21N3OS3 and a molecular weight of 391.59 g/mol. Its IUPAC name is 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 9095240 |
| Molecular Formula | C18H21N3OS3 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-[[2-(4-methylphenyl)sulfanylacetyl]amino]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | Cc1ccc(SCC(=O)NNC(=S)NCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3OS3/c1-14-7-9-16(10-8-14)25-13-17(22)20-21-18(23)19-11-12-24-15-5-3-2-4-6-15/h2-10H,11-13H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | KPKHLQMBAXBHBW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|