C19H21NO3S2 — CID 7630193
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-phenylsulfanylacetate (PubChem CID 7630193) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-phenylsulfanylacetate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 7630193 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-phenylsulfanylacetate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3S2/c1-15-7-9-17(10-8-15)24-12-11-20-18(21)13-23-19(22)14-25-16-5-3-2-4-6-16/h2-10H,11-14H2,1H3,(H,20,21) |
| InChIKey | QOANOWUASGBPBL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|