C19H19Cl2NO3S — CID 7604285
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate (PubChem CID 7604285) has the molecular formula C19H19Cl2NO3S and a molecular weight of 412.34 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7604285 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(2,4-dichlorophenyl)acetate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-13-2-6-16(7-3-13)26-9-8-22-18(23)12-25-19(24)10-14-4-5-15(20)11-17(14)21/h2-7,11H,8-10,12H2,1H3,(H,22,23) |
| InChIKey | VSGIPZOQLBECHB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|