C19H20BrNO3S — CID 33195214
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate (PubChem CID 33195214) has the molecular formula C19H20BrNO3S and a molecular weight of 422.34 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 33195214 |
| Molecular Formula | C19H20BrNO3S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 2-(4-bromophenyl)acetate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H20BrNO3S/c1-14-2-8-17(9-3-14)25-11-10-21-18(22)13-24-19(23)12-15-4-6-16(20)7-5-15/h2-9H,10-13H2,1H3,(H,21,22) |
| InChIKey | BGAJZFDPBOSARG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|