C22H24N2O3S — CID 7605261
[2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 7605261) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 7605261 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-[2-(4-methylphenyl)sulfanylethylamino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | Cc1ccc(SCCNC(=O)COC(=O)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-16-6-9-18(10-7-16)28-13-12-23-21(25)15-27-22(26)11-8-17-14-24-20-5-3-2-4-19(17)20/h2-7,9-10,14,24H,8,11-13,15H2,1H3,(H,23,25) |
| InChIKey | QUQMWQSBSJTPPZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|