C15H18N2O4 — CID 7960167
[2-(2-methoxyethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960167) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960167 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | COCCNC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H18N2O4/c1-20-7-6-16-14(18)10-21-15(19)8-11-9-17-13-5-3-2-4-12(11)13/h2-5,9,17H,6-8,10H2,1H3,(H,16,18) |
| InChIKey | FJHBAEUBQZZOSQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|