C15H17N3O4 — CID 4031786
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 4031786) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 4031786 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCNC(=O)NC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17N3O4/c1-2-16-15(21)18-13(19)9-22-14(20)7-10-8-17-12-6-4-3-5-11(10)12/h3-6,8,17H,2,7,9H2,1H3,(H2,16,18,19,21) |
| InChIKey | FTTFUCDXDYFATI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |