C17H21N3O4 — CID 9017656
[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 9017656) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 9017656 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCCNC(=O)CNC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H21N3O4/c1-2-7-18-15(21)10-20-16(22)11-24-17(23)8-12-9-19-14-6-4-3-5-13(12)14/h3-6,9,19H,2,7-8,10-11H2,1H3,(H,18,21)(H,20,22) |
| InChIKey | MIHLAHRTTHTWMC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |