C16H20N2O3 — CID 7960168
[2-(diethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960168) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960168 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CCN(CC)C(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H20N2O3/c1-3-18(4-2)15(19)11-21-16(20)9-12-10-17-14-8-6-5-7-13(12)14/h5-8,10,17H,3-4,9,11H2,1-2H3 |
| InChIKey | YVMJNKNJPCBNJC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |