About chloro 2-(1H-indol-3-yl)acetate
chloro 2-(1H-indol-3-yl)acetate (PubChem CID 174694401) has the molecular formula C10H8ClNO2
and a molecular weight of 209.63 g/mol. Its IUPAC name is chloro 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | chloro 2-(1H-indol-3-yl)acetate |
| PubChem CID | 174694401 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | chloro 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCl |
| InChI | InChI=1S/C10H8ClNO2/c11-14-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2 |
| InChIKey | FCUZGGQTEKQVRL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 2-(1H-indol-3-yl)acetate?
The IUPAC name of chloro 2-(1H-indol-3-yl)acetate (CID 174694401) is chloro 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for chloro 2-(1H-indol-3-yl)acetate?
The canonical SMILES for chloro 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)OCl.
What is the InChIKey of chloro 2-(1H-indol-3-yl)acetate?
The InChIKey is FCUZGGQTEKQVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2/c11-14-10(13)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2.
What are the key properties of chloro 2-(1H-indol-3-yl)acetate?
chloro 2-(1H-indol-3-yl)acetate has a molecular weight of 209.63 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 174694401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).