C11H9NO3Pb — CID 87710053
CID 87710053 (PubChem CID 87710053) has the molecular formula C11H9NO3Pb and a molecular weight of 410.40 g/mol.
| Compound Name | CID 87710053 |
|---|---|
| PubChem CID | 87710053 |
| Molecular Formula | C11H9NO3Pb |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | — |
| SMILES | O=C(O)C(=O)Cc1c[nH]c2ccccc12.[Pb] |
| InChI | InChI=1S/C11H9NO3.Pb/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9;/h1-4,6,12H,5H2,(H,14,15); |
| InChIKey | MHRJZJWZQVINTQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|