C22H20N2O6 — CID 161436162
1H-indole;3-(1H-indol-3-yl)-2-oxopropanoic acid;2-oxopropanoic acid (PubChem CID 161436162) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 1H-indole;3-(1H-indol-3-yl)-2-oxopropanoic acid;2-oxopropanoic acid.
| Compound Name | 1H-indole;3-(1H-indol-3-yl)-2-oxopropanoic acid;2-oxopropanoic acid |
|---|---|
| PubChem CID | 161436162 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1H-indole;3-(1H-indol-3-yl)-2-oxopropanoic acid;2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.O=C(O)C(=O)Cc1c[nH]c2ccccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C11H9NO3.C8H7N.C3H4O3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9;1-2-4-8-7(3-1)5-6-9-8;1-2(4)3(5)6/h1-4,6,12H,5H2,(H,14,15);1-6,9H;1H3,(H,5,6) |
| InChIKey | VYRCUABQNCJHDN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|