About bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+)
bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) (PubChem CID 87710054) has the molecular formula C22H16N2O6Pb
and a molecular weight of 611.58 g/mol. Its IUPAC name is bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+).
Molecular Properties
| Compound Name | bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) |
| PubChem CID | 87710054 |
| Molecular Formula | C22H16N2O6Pb |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 612.08 |
| IUPAC Name | bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) |
| SMILES | O=C([O-])C(=O)Cc1c[nH]c2ccccc12.O=C([O-])C(=O)Cc1c[nH]c2ccccc12.[Pb+2] |
| InChI | InChI=1S/2C11H9NO3.Pb/c2*13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9;/h2*1-4,6,12H,5H2,(H,14,15);/q;;+2/p-2 |
| InChIKey | FAKQFGSKAYXQMH-UHFFFAOYSA-L |
| XLogP | -0.32 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+)?
The IUPAC name of bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) (CID 87710054) is bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+).
What is the SMILES notation for bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+)?
The canonical SMILES for bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) is O=C([O-])C(=O)Cc1c[nH]c2ccccc12.O=C([O-])C(=O)Cc1c[nH]c2ccccc12.[Pb+2].
What is the InChIKey of bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+)?
The InChIKey is FAKQFGSKAYXQMH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H9NO3.Pb/c2*13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9;/h2*1-4,6,12H,5H2,(H,14,15);/q;;+2/p-2.
What are the key properties of bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+)?
bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) has a molecular weight of 611.58 g/mol, XLogP of -0.32, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-(1H-indol-3-yl)-2-oxopropanoate);lead(2+) is sourced from PubChem (CID 87710054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).