C11H11N2O4- — CID 75107009
2-(dihydroxyamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 75107009) has the molecular formula C11H11N2O4- and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-(dihydroxyamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | 2-(dihydroxyamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 75107009 |
| Molecular Formula | C11H11N2O4- |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-(dihydroxyamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C([O-])C(Cc1c[nH]c2ccccc12)N(O)O |
| InChI | InChI=1S/C11H12N2O4/c14-11(15)10(13(16)17)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12,16-17H,5H2,(H,14,15)/p-1 |
| InChIKey | FKJQZUQEYSGYFZ-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|