C10H11NO2 — CID 21400411
2-(1H-indol-3-yl)ethane-1,1-diol (PubChem CID 21400411) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethane-1,1-diol.
| Compound Name | 2-(1H-indol-3-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 21400411 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-(1H-indol-3-yl)ethane-1,1-diol |
| SMILES | OC(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H11NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,10-13H,5H2 |
| InChIKey | PGZPVOBZCAEBGT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|