C11H13NO2 — CID 22219738
3-(1H-indol-3-yl)propane-1,1-diol (PubChem CID 22219738) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)propane-1,1-diol.
| Compound Name | 3-(1H-indol-3-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 22219738 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-(1H-indol-3-yl)propane-1,1-diol |
| SMILES | OC(O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C11H13NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,11-14H,5-6H2 |
| InChIKey | MNULMIBLOSQHNE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|