About 2-(1H-indol-3-yl)ethanol;nitrous acid
2-(1H-indol-3-yl)ethanol;nitrous acid (PubChem CID 162624024) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethanol;nitrous acid.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)ethanol;nitrous acid |
| PubChem CID | 162624024 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(1H-indol-3-yl)ethanol;nitrous acid |
| SMILES | O=NO.OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H11NO.HNO2/c12-6-5-8-7-11-10-4-2-1-3-9(8)10;2-1-3/h1-4,7,11-12H,5-6H2;(H,2,3) |
| InChIKey | ULIWRLNSZYQVGX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-indol-3-yl)ethanol;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)ethanol;nitrous acid?
The IUPAC name of 2-(1H-indol-3-yl)ethanol;nitrous acid (CID 162624024) is 2-(1H-indol-3-yl)ethanol;nitrous acid.
What is the SMILES notation for 2-(1H-indol-3-yl)ethanol;nitrous acid?
The canonical SMILES for 2-(1H-indol-3-yl)ethanol;nitrous acid is O=NO.OCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)ethanol;nitrous acid?
The InChIKey is ULIWRLNSZYQVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.HNO2/c12-6-5-8-7-11-10-4-2-1-3-9(8)10;2-1-3/h1-4,7,11-12H,5-6H2;(H,2,3).
What are the key properties of 2-(1H-indol-3-yl)ethanol;nitrous acid?
2-(1H-indol-3-yl)ethanol;nitrous acid has a molecular weight of 208.22 g/mol, XLogP of 1.84, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)ethanol;nitrous acid is sourced from PubChem (CID 162624024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).