C14H20N2O3 — CID 174964021
2-aminoethanol;4-(1H-indol-3-yl)butanoic acid (PubChem CID 174964021) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-aminoethanol;4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 2-aminoethanol;4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 174964021 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-aminoethanol;4-(1H-indol-3-yl)butanoic acid |
| SMILES | NCCO.O=C(O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13NO2.C2H7NO/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;3-1-2-4/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);4H,1-3H2 |
| InChIKey | JUIIHJRDDJCVPV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |