C12H15NNa2O2 — CID 174726095
disodium;hydride;4-(1H-indol-3-yl)butanoic acid (PubChem CID 174726095) has the molecular formula C12H15NNa2O2 and a molecular weight of 251.24 g/mol. Its IUPAC name is disodium;hydride;4-(1H-indol-3-yl)butanoic acid.
| Compound Name | disodium;hydride;4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 174726095 |
| Molecular Formula | C12H15NNa2O2 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | disodium;hydride;4-(1H-indol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCc1c[nH]c2ccccc12.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C12H13NO2.2Na.2H/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;;;;/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);;;;/q;2*+1;2*-1 |
| InChIKey | FTTMEVQFYZGHDS-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |