C18H17NO3 — CID 149029934
1-(2,6-dihydroxyphenyl)-4-(1H-indol-3-yl)butan-1-one (PubChem CID 149029934) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-(2,6-dihydroxyphenyl)-4-(1H-indol-3-yl)butan-1-one.
| Compound Name | 1-(2,6-dihydroxyphenyl)-4-(1H-indol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 149029934 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-(2,6-dihydroxyphenyl)-4-(1H-indol-3-yl)butan-1-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)c1c(O)cccc1O |
| InChI | InChI=1S/C18H17NO3/c20-15(18-16(21)9-4-10-17(18)22)8-3-5-12-11-19-14-7-2-1-6-13(12)14/h1-2,4,6-7,9-11,19,21-22H,3,5,8H2 |
| InChIKey | QFGASHJQIMORDB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |