C11H11N2O3- — CID 45266744
(2S)-2-(hydroxyamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 45266744) has the molecular formula C11H11N2O3- and a molecular weight of 219.22 g/mol. Its IUPAC name is (2S)-2-(hydroxyamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | (2S)-2-(hydroxyamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 45266744 |
| Molecular Formula | C11H11N2O3- |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (2S)-2-(hydroxyamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C([O-])[C@H](Cc1c[nH]c2ccccc12)NO |
| InChI | InChI=1S/C11H12N2O3/c14-11(15)10(13-16)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13,16H,5H2,(H,14,15)/p-1/t10-/m0/s1 |
| InChIKey | PNBGTYVVHKDDFM-JTQLQIEISA-M |
| XLogP | -0.19 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|