C24H19N3O2 — CID 7091588
(2R)-2-(acridin-10-ium-9-ylamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 7091588) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is (2R)-2-(acridin-10-ium-9-ylamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | (2R)-2-(acridin-10-ium-9-ylamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 7091588 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (2R)-2-(acridin-10-ium-9-ylamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C([O-])[C@@H](Cc1c[nH]c2ccccc12)Nc1c2ccccc2[nH+]c2ccccc12 |
| InChI | InChI=1S/C24H19N3O2/c28-24(29)22(13-15-14-25-19-10-4-1-7-16(15)19)27-23-17-8-2-5-11-20(17)26-21-12-6-3-9-18(21)23/h1-12,14,22,25H,13H2,(H,26,27)(H,28,29)/t22-/m1/s1 |
| InChIKey | KLTRUWFOTALXPO-JOCHJYFZSA-N |
| XLogP | 3.06 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|