C15H14N2O5-2 — CID 7310734
4-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate (PubChem CID 7310734) has the molecular formula C15H14N2O5-2 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate.
| Compound Name | 4-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7310734 |
| Molecular Formula | C15H14N2O5-2 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C15H16N2O5/c18-13(5-6-14(19)20)17-12(15(21)22)7-9-8-16-11-4-2-1-3-10(9)11/h1-4,8,12,16H,5-7H2,(H,17,18)(H,19,20)(H,21,22)/p-2/t12-/m0/s1 |
| InChIKey | SIZZGLHHFQZDEC-LBPRGKRZSA-L |
| XLogP | -1.52 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |