C16H18N3O5- — CID 6992139
(2R)-2-azaniumyl-5-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate (PubChem CID 6992139) has the molecular formula C16H18N3O5- and a molecular weight of 332.34 g/mol. Its IUPAC name is (2R)-2-azaniumyl-5-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate.
| Compound Name | (2R)-2-azaniumyl-5-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 6992139 |
| Molecular Formula | C16H18N3O5- |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2R)-2-azaniumyl-5-[[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate |
| SMILES | [NH3+][C@H](CCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C16H19N3O5/c17-11(15(21)22)5-6-14(20)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,20)(H,21,22)(H,23,24)/p-1/t11-,13+/m1/s1 |
| InChIKey | CATMPQFFVNKDEY-YPMHNXCESA-M |
| XLogP | -2.91 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |