C17H21N3O5 — CID 85064207
5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-(methylamino)-5-oxopentanoic acid (PubChem CID 85064207) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-(methylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 85064207 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 5-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-2-(methylamino)-5-oxopentanoic acid |
| SMILES | CNC(CCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c1-18-13(16(22)23)6-7-15(21)20-14(17(24)25)8-10-9-19-12-5-3-2-4-11(10)12/h2-5,9,13-14,18-19H,6-8H2,1H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | NMAIQUGHHDKLNO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |