C19H27N2NaO3 — CID 175251451
sodium;hydride;(2S)-3-(1H-indol-3-yl)-2-(octanoylamino)propanoic acid (PubChem CID 175251451) has the molecular formula C19H27N2NaO3 and a molecular weight of 354.43 g/mol. Its IUPAC name is sodium;hydride;(2S)-3-(1H-indol-3-yl)-2-(octanoylamino)propanoic acid.
| Compound Name | sodium;hydride;(2S)-3-(1H-indol-3-yl)-2-(octanoylamino)propanoic acid |
|---|---|
| PubChem CID | 175251451 |
| Molecular Formula | C19H27N2NaO3 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | sodium;hydride;(2S)-3-(1H-indol-3-yl)-2-(octanoylamino)propanoic acid |
| SMILES | CCCCCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C19H26N2O3.Na.H/c1-2-3-4-5-6-11-18(22)21-17(19(23)24)12-14-13-20-16-10-8-7-9-15(14)16;;/h7-10,13,17,20H,2-6,11-12H2,1H3,(H,21,22)(H,23,24);;/q;+1;-1/t17-;;/m0../s1 |
| InChIKey | JTNZYGOEOWLYHN-RMRYJAPISA-N |
| XLogP | 0.76 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|