C31H48N2O3 — CID 171117064
(2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 171117064) has the molecular formula C31H48N2O3 and a molecular weight of 496.74 g/mol. Its IUPAC name is (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 171117064 |
| Molecular Formula | C31H48N2O3 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | (2S)-2-[[(Z)-icos-11-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H48N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30(34)33-29(31(35)36)24-26-25-32-28-22-20-19-21-27(26)28/h9-10,19-22,25,29,32H,2-8,11-18,23-24H2,1H3,(H,33,34)(H,35,36)/b10-9-/t29-/m0/s1 |
| InChIKey | FLDHPYDJRXQOHA-FGCCJYTBSA-N |
| XLogP | 8.10 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|