C29H42N2O3 — CID 54399451
3-(1H-indol-3-yl)-2-(octadeca-9,12-dienoylamino)propanoic acid (PubChem CID 54399451) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-(octadeca-9,12-dienoylamino)propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-(octadeca-9,12-dienoylamino)propanoic acid |
|---|---|
| PubChem CID | 54399451 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-(octadeca-9,12-dienoylamino)propanoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H42N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-28(32)31-27(29(33)34)22-24-23-30-26-20-18-17-19-25(24)26/h6-7,9-10,17-20,23,27,30H,2-5,8,11-16,21-22H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | VMJGIIURAHPLEX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|