C26H38N2O3 — CID 171117057
(2S)-3-(1H-indol-3-yl)-2-[[(Z)-pentadec-9-enoyl]amino]propanoic acid (PubChem CID 171117057) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[[(Z)-pentadec-9-enoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[[(Z)-pentadec-9-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171117057 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[[(Z)-pentadec-9-enoyl]amino]propanoic acid |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H38N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-25(29)28-24(26(30)31)19-21-20-27-23-17-15-14-16-22(21)23/h6-7,14-17,20,24,27H,2-5,8-13,18-19H2,1H3,(H,28,29)(H,30,31)/b7-6-/t24-/m0/s1 |
| InChIKey | RIHNMIZEQCKCHX-POUSAUBHSA-N |
| XLogP | 6.15 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|