C29H43ClN2O3 — CID 57252882
3-(5-chloro-1H-indol-3-yl)-2-(octadec-9-enoylamino)propanoic acid (PubChem CID 57252882) has the molecular formula C29H43ClN2O3 and a molecular weight of 503.13 g/mol. Its IUPAC name is 3-(5-chloro-1H-indol-3-yl)-2-(octadec-9-enoylamino)propanoic acid.
| Compound Name | 3-(5-chloro-1H-indol-3-yl)-2-(octadec-9-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 57252882 |
| Molecular Formula | C29H43ClN2O3 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 3-(5-chloro-1H-indol-3-yl)-2-(octadec-9-enoylamino)propanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(Cc1c[nH]c2ccc(Cl)cc12)C(=O)O |
| InChI | InChI=1S/C29H43ClN2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28(33)32-27(29(34)35)20-23-22-31-26-19-18-24(30)21-25(23)26/h9-10,18-19,21-22,27,31H,2-8,11-17,20H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | VWABFSBVTCFTJX-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|