About bis(1H-indole);methanol
bis(1H-indole);methanol (PubChem CID 70305490) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is bis(1H-indole);methanol.
Molecular Properties
| Compound Name | bis(1H-indole);methanol |
| PubChem CID | 70305490 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | bis(1H-indole);methanol |
| SMILES | CO.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/2C8H7N.CH4O/c2*1-2-4-8-7(3-1)5-6-9-8;1-2/h2*1-6,9H;2H,1H3 |
| InChIKey | ILDXGSOFQBFSOW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(1H-indole);methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-indole);methanol?
The IUPAC name of bis(1H-indole);methanol (CID 70305490) is bis(1H-indole);methanol.
What is the SMILES notation for bis(1H-indole);methanol?
The canonical SMILES for bis(1H-indole);methanol is CO.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of bis(1H-indole);methanol?
The InChIKey is ILDXGSOFQBFSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7N.CH4O/c2*1-2-4-8-7(3-1)5-6-9-8;1-2/h2*1-6,9H;2H,1H3.
What are the key properties of bis(1H-indole);methanol?
bis(1H-indole);methanol has a molecular weight of 266.34 g/mol, XLogP of 3.94, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-indole);methanol is sourced from PubChem (CID 70305490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).