About formic acid;1H-indole
formic acid;1H-indole (PubChem CID 146381063) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is formic acid;1H-indole.
Molecular Properties
| Compound Name | formic acid;1H-indole |
| PubChem CID | 146381063 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | formic acid;1H-indole |
| SMILES | O=CO.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.CH2O2/c1-2-4-8-7(3-1)5-6-9-8;2-1-3/h1-6,9H;1H,(H,2,3) |
| InChIKey | XVMKYUCBGVLGRY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1H-indole?
The IUPAC name of formic acid;1H-indole (CID 146381063) is formic acid;1H-indole.
What is the SMILES notation for formic acid;1H-indole?
The canonical SMILES for formic acid;1H-indole is O=CO.c1ccc2[nH]ccc2c1.
What is the InChIKey of formic acid;1H-indole?
The InChIKey is XVMKYUCBGVLGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.CH2O2/c1-2-4-8-7(3-1)5-6-9-8;2-1-3/h1-6,9H;1H,(H,2,3).
What are the key properties of formic acid;1H-indole?
formic acid;1H-indole has a molecular weight of 163.18 g/mol, XLogP of 1.87, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1H-indole is sourced from PubChem (CID 146381063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).