About acetaldehyde;1H-indole
acetaldehyde;1H-indole (PubChem CID 22501409) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is acetaldehyde;1H-indole.
Molecular Properties
| Compound Name | acetaldehyde;1H-indole |
| PubChem CID | 22501409 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | acetaldehyde;1H-indole |
| SMILES | CC=O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C2H4O/c1-2-4-8-7(3-1)5-6-9-8;1-2-3/h1-6,9H;2H,1H3 |
| InChIKey | ALLMTRVKKCVGCP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1H-indole?
The IUPAC name of acetaldehyde;1H-indole (CID 22501409) is acetaldehyde;1H-indole.
What is the SMILES notation for acetaldehyde;1H-indole?
The canonical SMILES for acetaldehyde;1H-indole is CC=O.c1ccc2[nH]ccc2c1.
What is the InChIKey of acetaldehyde;1H-indole?
The InChIKey is ALLMTRVKKCVGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C2H4O/c1-2-4-8-7(3-1)5-6-9-8;1-2-3/h1-6,9H;2H,1H3.
What are the key properties of acetaldehyde;1H-indole?
acetaldehyde;1H-indole has a molecular weight of 161.20 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1H-indole is sourced from PubChem (CID 22501409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).