About 2-(1H-indol-3-yl)-N,N-dimethylethanamine
2-(1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 6089) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| PubChem CID | 6089 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | DMULVCHRPCFFGV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1H-indol-3-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(1H-indol-3-yl)-N,N-dimethylethanamine (CID 6089) is 2-(1H-indol-3-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(1H-indol-3-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(1H-indol-3-yl)-N,N-dimethylethanamine is CN(C)CCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)-N,N-dimethylethanamine?
The InChIKey is DMULVCHRPCFFGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3.
What are the key properties of 2-(1H-indol-3-yl)-N,N-dimethylethanamine?
2-(1H-indol-3-yl)-N,N-dimethylethanamine has a molecular weight of 188.27 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 6089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).