About ethane;1H-indole;methane
ethane;1H-indole;methane (PubChem CID 169425426) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;1H-indole;methane.
Molecular Properties
| Compound Name | ethane;1H-indole;methane |
| PubChem CID | 169425426 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;1H-indole;methane |
| SMILES | C.CC.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C2H6.CH4/c1-2-4-8-7(3-1)5-6-9-8;1-2;/h1-6,9H;1-2H3;1H4 |
| InChIKey | GLWVTOSNINPDCD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1H-indole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1H-indole;methane?
The IUPAC name of ethane;1H-indole;methane (CID 169425426) is ethane;1H-indole;methane.
What is the SMILES notation for ethane;1H-indole;methane?
The canonical SMILES for ethane;1H-indole;methane is C.CC.c1ccc2[nH]ccc2c1.
What is the InChIKey of ethane;1H-indole;methane?
The InChIKey is GLWVTOSNINPDCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C2H6.CH4/c1-2-4-8-7(3-1)5-6-9-8;1-2;/h1-6,9H;1-2H3;1H4.
What are the key properties of ethane;1H-indole;methane?
ethane;1H-indole;methane has a molecular weight of 163.26 g/mol, XLogP of 3.83, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1H-indole;methane is sourced from PubChem (CID 169425426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).