About heptane;1H-indole
heptane;1H-indole (PubChem CID 162212083) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is heptane;1H-indole.
Molecular Properties
| Compound Name | heptane;1H-indole |
| PubChem CID | 162212083 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | heptane;1H-indole |
| SMILES | CCCCCCC.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C7H16/c1-2-4-8-7(3-1)5-6-9-8;1-3-5-7-6-4-2/h1-6,9H;3-7H2,1-2H3 |
| InChIKey | ZSZFBGOWMHPPTP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptane;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane;1H-indole?
The IUPAC name of heptane;1H-indole (CID 162212083) is heptane;1H-indole.
What is the SMILES notation for heptane;1H-indole?
The canonical SMILES for heptane;1H-indole is CCCCCCC.c1ccc2[nH]ccc2c1.
What is the InChIKey of heptane;1H-indole?
The InChIKey is ZSZFBGOWMHPPTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H16/c1-2-4-8-7(3-1)5-6-9-8;1-3-5-7-6-4-2/h1-6,9H;3-7H2,1-2H3.
What are the key properties of heptane;1H-indole?
heptane;1H-indole has a molecular weight of 217.36 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptane;1H-indole is sourced from PubChem (CID 162212083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).