About 2-O-butyl 1-O-methyl oxalate;1H-indole
2-O-butyl 1-O-methyl oxalate;1H-indole (PubChem CID 19754418) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-O-butyl 1-O-methyl oxalate;1H-indole.
Molecular Properties
| Compound Name | 2-O-butyl 1-O-methyl oxalate;1H-indole |
| PubChem CID | 19754418 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-O-butyl 1-O-methyl oxalate;1H-indole |
| SMILES | CCCCOC(=O)C(=O)OC.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C7H12O4/c1-2-4-8-7(3-1)5-6-9-8;1-3-4-5-11-7(9)6(8)10-2/h1-6,9H;3-5H2,1-2H3 |
| InChIKey | XPUULVRAUNHZBD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-butyl 1-O-methyl oxalate;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-butyl 1-O-methyl oxalate;1H-indole?
The IUPAC name of 2-O-butyl 1-O-methyl oxalate;1H-indole (CID 19754418) is 2-O-butyl 1-O-methyl oxalate;1H-indole.
What is the SMILES notation for 2-O-butyl 1-O-methyl oxalate;1H-indole?
The canonical SMILES for 2-O-butyl 1-O-methyl oxalate;1H-indole is CCCCOC(=O)C(=O)OC.c1ccc2[nH]ccc2c1.
What is the InChIKey of 2-O-butyl 1-O-methyl oxalate;1H-indole?
The InChIKey is XPUULVRAUNHZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H12O4/c1-2-4-8-7(3-1)5-6-9-8;1-3-4-5-11-7(9)6(8)10-2/h1-6,9H;3-5H2,1-2H3.
What are the key properties of 2-O-butyl 1-O-methyl oxalate;1H-indole?
2-O-butyl 1-O-methyl oxalate;1H-indole has a molecular weight of 277.32 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-butyl 1-O-methyl oxalate;1H-indole is sourced from PubChem (CID 19754418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).