About hexyl 1H-indole-5-carboxylate
hexyl 1H-indole-5-carboxylate (PubChem CID 90708672) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is hexyl 1H-indole-5-carboxylate.
Molecular Properties
| Compound Name | hexyl 1H-indole-5-carboxylate |
| PubChem CID | 90708672 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | hexyl 1H-indole-5-carboxylate |
| SMILES | CCCCCCOC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H19NO2/c1-2-3-4-5-10-18-15(17)13-6-7-14-12(11-13)8-9-16-14/h6-9,11,16H,2-5,10H2,1H3 |
| InChIKey | NWXUYUIPJJDSIY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 1H-indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 1H-indole-5-carboxylate?
The IUPAC name of hexyl 1H-indole-5-carboxylate (CID 90708672) is hexyl 1H-indole-5-carboxylate.
What is the SMILES notation for hexyl 1H-indole-5-carboxylate?
The canonical SMILES for hexyl 1H-indole-5-carboxylate is CCCCCCOC(=O)c1ccc2[nH]ccc2c1.
What is the InChIKey of hexyl 1H-indole-5-carboxylate?
The InChIKey is NWXUYUIPJJDSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-2-3-4-5-10-18-15(17)13-6-7-14-12(11-13)8-9-16-14/h6-9,11,16H,2-5,10H2,1H3.
What are the key properties of hexyl 1H-indole-5-carboxylate?
hexyl 1H-indole-5-carboxylate has a molecular weight of 245.32 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 1H-indole-5-carboxylate is sourced from PubChem (CID 90708672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).